C27H26N2O2 — CID 3491439
1-[2-(2-methoxyphenyl)ethyl]-2-methyl-4,5-diphenylpyrrole-3-carboxamide (PubChem CID 3491439) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenyl)ethyl]-2-methyl-4,5-diphenylpyrrole-3-carboxamide.
| Compound Name | 1-[2-(2-methoxyphenyl)ethyl]-2-methyl-4,5-diphenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3491439 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 1-[2-(2-methoxyphenyl)ethyl]-2-methyl-4,5-diphenylpyrrole-3-carboxamide |
| SMILES | COc1ccccc1CCn1c(C)c(C(N)=O)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C27H26N2O2/c1-19-24(27(28)30)25(21-12-5-3-6-13-21)26(22-14-7-4-8-15-22)29(19)18-17-20-11-9-10-16-23(20)31-2/h3-16H,17-18H2,1-2H3,(H2,28,30) |
| InChIKey | QRBSSBRZXLGBDD-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |