C25H21ClN2O — CID 3491442
1-[(4-chlorophenyl)methyl]-2-methyl-4,5-diphenylpyrrole-3-carboxamide (PubChem CID 3491442) has the molecular formula C25H21ClN2O and a molecular weight of 400.91 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-methyl-4,5-diphenylpyrrole-3-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-methyl-4,5-diphenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3491442 |
| Molecular Formula | C25H21ClN2O |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-methyl-4,5-diphenylpyrrole-3-carboxamide |
| SMILES | Cc1c(C(N)=O)c(-c2ccccc2)c(-c2ccccc2)n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H21ClN2O/c1-17-22(25(27)29)23(19-8-4-2-5-9-19)24(20-10-6-3-7-11-20)28(17)16-18-12-14-21(26)15-13-18/h2-15H,16H2,1H3,(H2,27,29) |
| InChIKey | AZQXDXCHIPYYDS-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |