C26H23FN2O — CID 3814503
1-[2-(3-fluorophenyl)ethyl]-2-methyl-4,5-diphenylpyrrole-3-carboxamide (PubChem CID 3814503) has the molecular formula C26H23FN2O and a molecular weight of 398.48 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethyl]-2-methyl-4,5-diphenylpyrrole-3-carboxamide.
| Compound Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-4,5-diphenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3814503 |
| Molecular Formula | C26H23FN2O |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-4,5-diphenylpyrrole-3-carboxamide |
| SMILES | Cc1c(C(N)=O)c(-c2ccccc2)c(-c2ccccc2)n1CCc1cccc(F)c1 |
| InChI | InChI=1S/C26H23FN2O/c1-18-23(26(28)30)24(20-10-4-2-5-11-20)25(21-12-6-3-7-13-21)29(18)16-15-19-9-8-14-22(27)17-19/h2-14,17H,15-16H2,1H3,(H2,28,30) |
| InChIKey | SYQLGOBFHUYJGA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |