C23H34N2O2 — CID 3608133
5-butyl-4-(4-methoxy-3-methylphenyl)-2-methyl-1-(3-methylbutyl)pyrrole-3-carboxamide (PubChem CID 3608133) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 5-butyl-4-(4-methoxy-3-methylphenyl)-2-methyl-1-(3-methylbutyl)pyrrole-3-carboxamide.
| Compound Name | 5-butyl-4-(4-methoxy-3-methylphenyl)-2-methyl-1-(3-methylbutyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3608133 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 5-butyl-4-(4-methoxy-3-methylphenyl)-2-methyl-1-(3-methylbutyl)pyrrole-3-carboxamide |
| SMILES | CCCCc1c(-c2ccc(OC)c(C)c2)c(C(N)=O)c(C)n1CCC(C)C |
| InChI | InChI=1S/C23H34N2O2/c1-7-8-9-19-22(18-10-11-20(27-6)16(4)14-18)21(23(24)26)17(5)25(19)13-12-15(2)3/h10-11,14-15H,7-9,12-13H2,1-6H3,(H2,24,26) |
| InChIKey | GIFSQJLQVHLIAJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |