C22H31N3O — CID 3340286
4-[4-(dimethylamino)phenyl]-2-methyl-5-pentyl-1-prop-2-enylpyrrole-3-carboxamide (PubChem CID 3340286) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-[4-(dimethylamino)phenyl]-2-methyl-5-pentyl-1-prop-2-enylpyrrole-3-carboxamide.
| Compound Name | 4-[4-(dimethylamino)phenyl]-2-methyl-5-pentyl-1-prop-2-enylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3340286 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 4-[4-(dimethylamino)phenyl]-2-methyl-5-pentyl-1-prop-2-enylpyrrole-3-carboxamide |
| SMILES | C=CCn1c(C)c(C(N)=O)c(-c2ccc(N(C)C)cc2)c1CCCCC |
| InChI | InChI=1S/C22H31N3O/c1-6-8-9-10-19-21(17-11-13-18(14-12-17)24(4)5)20(22(23)26)16(3)25(19)15-7-2/h7,11-14H,2,6,8-10,15H2,1,3-5H3,(H2,23,26) |
| InChIKey | ODZZPOZUWLOIQU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|