C20H24N2O4 — CID 3741633
methyl 3-[4-carbamoyl-3-(4-methoxyphenyl)-5-methyl-1-prop-2-enylpyrrol-2-yl]propanoate (PubChem CID 3741633) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is methyl 3-[4-carbamoyl-3-(4-methoxyphenyl)-5-methyl-1-prop-2-enylpyrrol-2-yl]propanoate.
| Compound Name | methyl 3-[4-carbamoyl-3-(4-methoxyphenyl)-5-methyl-1-prop-2-enylpyrrol-2-yl]propanoate |
|---|---|
| PubChem CID | 3741633 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | methyl 3-[4-carbamoyl-3-(4-methoxyphenyl)-5-methyl-1-prop-2-enylpyrrol-2-yl]propanoate |
| SMILES | C=CCn1c(C)c(C(N)=O)c(-c2ccc(OC)cc2)c1CCC(=O)OC |
| InChI | InChI=1S/C20H24N2O4/c1-5-12-22-13(2)18(20(21)24)19(16(22)10-11-17(23)26-4)14-6-8-15(25-3)9-7-14/h5-9H,1,10-12H2,2-4H3,(H2,21,24) |
| InChIKey | BPZXQEJNFJLCQD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|