C19H23ClN2O3 — CID 3675838
methyl 3-[4-carbamoyl-3-(4-chlorophenyl)-5-methyl-1-propan-2-ylpyrrol-2-yl]propanoate (PubChem CID 3675838) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is methyl 3-[4-carbamoyl-3-(4-chlorophenyl)-5-methyl-1-propan-2-ylpyrrol-2-yl]propanoate.
| Compound Name | methyl 3-[4-carbamoyl-3-(4-chlorophenyl)-5-methyl-1-propan-2-ylpyrrol-2-yl]propanoate |
|---|---|
| PubChem CID | 3675838 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | methyl 3-[4-carbamoyl-3-(4-chlorophenyl)-5-methyl-1-propan-2-ylpyrrol-2-yl]propanoate |
| SMILES | COC(=O)CCc1c(-c2ccc(Cl)cc2)c(C(N)=O)c(C)n1C(C)C |
| InChI | InChI=1S/C19H23ClN2O3/c1-11(2)22-12(3)17(19(21)24)18(13-5-7-14(20)8-6-13)15(22)9-10-16(23)25-4/h5-8,11H,9-10H2,1-4H3,(H2,21,24) |
| InChIKey | ZQAKOZUOTRUNIX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |