C25H37N3O — CID 3668885
4-(4-tert-butylphenyl)-5-ethyl-2-methyl-1-(2-piperidin-1-ylethyl)pyrrole-3-carboxamide (PubChem CID 3668885) has the molecular formula C25H37N3O and a molecular weight of 395.59 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-5-ethyl-2-methyl-1-(2-piperidin-1-ylethyl)pyrrole-3-carboxamide.
| Compound Name | 4-(4-tert-butylphenyl)-5-ethyl-2-methyl-1-(2-piperidin-1-ylethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3668885 |
| Molecular Formula | C25H37N3O |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | 4-(4-tert-butylphenyl)-5-ethyl-2-methyl-1-(2-piperidin-1-ylethyl)pyrrole-3-carboxamide |
| SMILES | CCc1c(-c2ccc(C(C)(C)C)cc2)c(C(N)=O)c(C)n1CCN1CCCCC1 |
| InChI | InChI=1S/C25H37N3O/c1-6-21-23(19-10-12-20(13-11-19)25(3,4)5)22(24(26)29)18(2)28(21)17-16-27-14-8-7-9-15-27/h10-13H,6-9,14-17H2,1-5H3,(H2,26,29) |
| InChIKey | NAMVOKNHPKHGRH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |