C22H23ClN2O2 — CID 3702538
1-[(3-chlorophenyl)methyl]-4-(3-hydroxyphenyl)-2-methyl-5-propylpyrrole-3-carboxamide (PubChem CID 3702538) has the molecular formula C22H23ClN2O2 and a molecular weight of 382.89 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-4-(3-hydroxyphenyl)-2-methyl-5-propylpyrrole-3-carboxamide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-4-(3-hydroxyphenyl)-2-methyl-5-propylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3702538 |
| Molecular Formula | C22H23ClN2O2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-4-(3-hydroxyphenyl)-2-methyl-5-propylpyrrole-3-carboxamide |
| SMILES | CCCc1c(-c2cccc(O)c2)c(C(N)=O)c(C)n1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H23ClN2O2/c1-3-6-19-21(16-8-5-10-18(26)12-16)20(22(24)27)14(2)25(19)13-15-7-4-9-17(23)11-15/h4-5,7-12,26H,3,6,13H2,1-2H3,(H2,24,27) |
| InChIKey | FAWWYVAQTXFCFG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |