C35H35N5O3 — CID 69046538
2-[2-methyl-5-(3-morpholin-4-ylpropoxy)phenyl]-4-[(4-phenylquinazolin-2-yl)amino]benzamide (PubChem CID 69046538) has the molecular formula C35H35N5O3 and a molecular weight of 573.70 g/mol. Its IUPAC name is 2-[2-methyl-5-(3-morpholin-4-ylpropoxy)phenyl]-4-[(4-phenylquinazolin-2-yl)amino]benzamide.
| Compound Name | 2-[2-methyl-5-(3-morpholin-4-ylpropoxy)phenyl]-4-[(4-phenylquinazolin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 69046538 |
| Molecular Formula | C35H35N5O3 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | 2-[2-methyl-5-(3-morpholin-4-ylpropoxy)phenyl]-4-[(4-phenylquinazolin-2-yl)amino]benzamide |
| SMILES | Cc1ccc(OCCCN2CCOCC2)cc1-c1cc(Nc2nc(-c3ccccc3)c3ccccc3n2)ccc1C(N)=O |
| InChI | InChI=1S/C35H35N5O3/c1-24-12-14-27(43-19-7-16-40-17-20-42-21-18-40)23-30(24)31-22-26(13-15-28(31)34(36)41)37-35-38-32-11-6-5-10-29(32)33(39-35)25-8-3-2-4-9-25/h2-6,8-15,22-23H,7,16-21H2,1H3,(H2,36,41)(H,37,38,39) |
| InChIKey | NYPCZJDVZKVIGQ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|