C27H32N4O5 — CID 91561241
2-cyclopropyl-2-[2-(3-methoxyphenyl)-6-(3-morpholin-4-ylpropoxy)-4-oxoquinazolin-3-yl]acetamide (PubChem CID 91561241) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is 2-cyclopropyl-2-[2-(3-methoxyphenyl)-6-(3-morpholin-4-ylpropoxy)-4-oxoquinazolin-3-yl]acetamide.
| Compound Name | 2-cyclopropyl-2-[2-(3-methoxyphenyl)-6-(3-morpholin-4-ylpropoxy)-4-oxoquinazolin-3-yl]acetamide |
|---|---|
| PubChem CID | 91561241 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 2-cyclopropyl-2-[2-(3-methoxyphenyl)-6-(3-morpholin-4-ylpropoxy)-4-oxoquinazolin-3-yl]acetamide |
| SMILES | COc1cccc(-c2nc3ccc(OCCCN4CCOCC4)cc3c(=O)n2C(C(N)=O)C2CC2)c1 |
| InChI | InChI=1S/C27H32N4O5/c1-34-20-5-2-4-19(16-20)26-29-23-9-8-21(36-13-3-10-30-11-14-35-15-12-30)17-22(23)27(33)31(26)24(25(28)32)18-6-7-18/h2,4-5,8-9,16-18,24H,3,6-7,10-15H2,1H3,(H2,28,32) |
| InChIKey | RCLSINJXMLKCLQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|