C25H21ClN4O2 — CID 75511167
[4-[[4-(4-chlorophenyl)quinazolin-2-yl]amino]phenyl]-morpholin-4-ylmethanone (PubChem CID 75511167) has the molecular formula C25H21ClN4O2 and a molecular weight of 444.92 g/mol. Its IUPAC name is [4-[[4-(4-chlorophenyl)quinazolin-2-yl]amino]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[[4-(4-chlorophenyl)quinazolin-2-yl]amino]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 75511167 |
| Molecular Formula | C25H21ClN4O2 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | [4-[[4-(4-chlorophenyl)quinazolin-2-yl]amino]phenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(Nc2nc(-c3ccc(Cl)cc3)c3ccccc3n2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C25H21ClN4O2/c26-19-9-5-17(6-10-19)23-21-3-1-2-4-22(21)28-25(29-23)27-20-11-7-18(8-12-20)24(31)30-13-15-32-16-14-30/h1-12H,13-16H2,(H,27,28,29) |
| InChIKey | BQNHISHWGZDULP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |