C30H25N5O2 — CID 25071136
4-[2-[4-[(2,6-dimethylphenyl)carbamoyl]anilino]quinazolin-4-yl]benzamide (PubChem CID 25071136) has the molecular formula C30H25N5O2 and a molecular weight of 487.56 g/mol. Its IUPAC name is 4-[2-[4-[(2,6-dimethylphenyl)carbamoyl]anilino]quinazolin-4-yl]benzamide.
| Compound Name | 4-[2-[4-[(2,6-dimethylphenyl)carbamoyl]anilino]quinazolin-4-yl]benzamide |
|---|---|
| PubChem CID | 25071136 |
| Molecular Formula | C30H25N5O2 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 4-[2-[4-[(2,6-dimethylphenyl)carbamoyl]anilino]quinazolin-4-yl]benzamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1ccc(Nc2nc(-c3ccc(C(N)=O)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C30H25N5O2/c1-18-6-5-7-19(2)26(18)34-29(37)22-14-16-23(17-15-22)32-30-33-25-9-4-3-8-24(25)27(35-30)20-10-12-21(13-11-20)28(31)36/h3-17H,1-2H3,(H2,31,36)(H,34,37)(H,32,33,35) |
| InChIKey | XQFZHCMYWTTWRF-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |