C24H22N4O3S — CID 69091103
N-(2,6-dimethylphenyl)-4-[(4-methylsulfonylquinazolin-2-yl)amino]benzamide (PubChem CID 69091103) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-[(4-methylsulfonylquinazolin-2-yl)amino]benzamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-[(4-methylsulfonylquinazolin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 69091103 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-[(4-methylsulfonylquinazolin-2-yl)amino]benzamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1ccc(Nc2nc(S(C)(=O)=O)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C24H22N4O3S/c1-15-7-6-8-16(2)21(15)27-22(29)17-11-13-18(14-12-17)25-24-26-20-10-5-4-9-19(20)23(28-24)32(3,30)31/h4-14H,1-3H3,(H,27,29)(H,25,26,28) |
| InChIKey | KRQFQIISKARGNR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |