C29H30N4O — CID 174721221
4-[(4-cyclohexylquinazolin-2-yl)amino]-N-(3,5-dimethylphenyl)benzamide (PubChem CID 174721221) has the molecular formula C29H30N4O and a molecular weight of 450.59 g/mol. Its IUPAC name is 4-[(4-cyclohexylquinazolin-2-yl)amino]-N-(3,5-dimethylphenyl)benzamide.
| Compound Name | 4-[(4-cyclohexylquinazolin-2-yl)amino]-N-(3,5-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 174721221 |
| Molecular Formula | C29H30N4O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 4-[(4-cyclohexylquinazolin-2-yl)amino]-N-(3,5-dimethylphenyl)benzamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2ccc(Nc3nc(C4CCCCC4)c4ccccc4n3)cc2)c1 |
| InChI | InChI=1S/C29H30N4O/c1-19-16-20(2)18-24(17-19)30-28(34)22-12-14-23(15-13-22)31-29-32-26-11-7-6-10-25(26)27(33-29)21-8-4-3-5-9-21/h6-7,10-18,21H,3-5,8-9H2,1-2H3,(H,30,34)(H,31,32,33) |
| InChIKey | RWOIRXMHXLLQDG-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |