C33H30N4O — CID 159012205
N-[5-(2-cyclopropylethyl)-2-methylphenyl]-4-[(4-phenylquinazolin-2-yl)amino]benzamide (PubChem CID 159012205) has the molecular formula C33H30N4O and a molecular weight of 498.63 g/mol. Its IUPAC name is N-[5-(2-cyclopropylethyl)-2-methylphenyl]-4-[(4-phenylquinazolin-2-yl)amino]benzamide.
| Compound Name | N-[5-(2-cyclopropylethyl)-2-methylphenyl]-4-[(4-phenylquinazolin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 159012205 |
| Molecular Formula | C33H30N4O |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | N-[5-(2-cyclopropylethyl)-2-methylphenyl]-4-[(4-phenylquinazolin-2-yl)amino]benzamide |
| SMILES | Cc1ccc(CCC2CC2)cc1NC(=O)c1ccc(Nc2nc(-c3ccccc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C33H30N4O/c1-22-11-12-24(16-15-23-13-14-23)21-30(22)35-32(38)26-17-19-27(20-18-26)34-33-36-29-10-6-5-9-28(29)31(37-33)25-7-3-2-4-8-25/h2-12,17-21,23H,13-16H2,1H3,(H,35,38)(H,34,36,37) |
| InChIKey | WFBVGSJKCIMGCL-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |