C28H21ClN4O — CID 140595625
N-[4-[(6-chloro-4-phenylquinazolin-2-yl)amino]-2-methylphenyl]benzamide (PubChem CID 140595625) has the molecular formula C28H21ClN4O and a molecular weight of 464.96 g/mol. Its IUPAC name is N-[4-[(6-chloro-4-phenylquinazolin-2-yl)amino]-2-methylphenyl]benzamide.
| Compound Name | N-[4-[(6-chloro-4-phenylquinazolin-2-yl)amino]-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 140595625 |
| Molecular Formula | C28H21ClN4O |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N-[4-[(6-chloro-4-phenylquinazolin-2-yl)amino]-2-methylphenyl]benzamide |
| SMILES | Cc1cc(Nc2nc(-c3ccccc3)c3cc(Cl)ccc3n2)ccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H21ClN4O/c1-18-16-22(13-15-24(18)31-27(34)20-10-6-3-7-11-20)30-28-32-25-14-12-21(29)17-23(25)26(33-28)19-8-4-2-5-9-19/h2-17H,1H3,(H,31,34)(H,30,32,33) |
| InChIKey | CYUBELMJGKCPSA-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |