C31H29N5O2 — CID 69045980
N-[3-[(2-hydroxyethylamino)methyl]-2-methylphenyl]-4-[(4-phenylquinazolin-2-yl)amino]benzamide (PubChem CID 69045980) has the molecular formula C31H29N5O2 and a molecular weight of 503.61 g/mol. Its IUPAC name is N-[3-[(2-hydroxyethylamino)methyl]-2-methylphenyl]-4-[(4-phenylquinazolin-2-yl)amino]benzamide.
| Compound Name | N-[3-[(2-hydroxyethylamino)methyl]-2-methylphenyl]-4-[(4-phenylquinazolin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 69045980 |
| Molecular Formula | C31H29N5O2 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | N-[3-[(2-hydroxyethylamino)methyl]-2-methylphenyl]-4-[(4-phenylquinazolin-2-yl)amino]benzamide |
| SMILES | Cc1c(CNCCO)cccc1NC(=O)c1ccc(Nc2nc(-c3ccccc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C31H29N5O2/c1-21-24(20-32-18-19-37)10-7-13-27(21)34-30(38)23-14-16-25(17-15-23)33-31-35-28-12-6-5-11-26(28)29(36-31)22-8-3-2-4-9-22/h2-17,32,37H,18-20H2,1H3,(H,34,38)(H,33,35,36) |
| InChIKey | AGWISIJUTMYQSQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|