C30H26N4O2 — CID 25069523
N-(2,6-dimethylphenyl)-4-[[4-(4-methoxyphenyl)quinazolin-2-yl]amino]benzamide (PubChem CID 25069523) has the molecular formula C30H26N4O2 and a molecular weight of 474.56 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-[[4-(4-methoxyphenyl)quinazolin-2-yl]amino]benzamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-[[4-(4-methoxyphenyl)quinazolin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 25069523 |
| Molecular Formula | C30H26N4O2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-[[4-(4-methoxyphenyl)quinazolin-2-yl]amino]benzamide |
| SMILES | COc1ccc(-c2nc(Nc3ccc(C(=O)Nc4c(C)cccc4C)cc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C30H26N4O2/c1-19-7-6-8-20(2)27(19)33-29(35)22-11-15-23(16-12-22)31-30-32-26-10-5-4-9-25(26)28(34-30)21-13-17-24(36-3)18-14-21/h4-18H,1-3H3,(H,33,35)(H,31,32,34) |
| InChIKey | XMSHSRIGRNQJSQ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |