C31H38N4O3 — CID 177379652
2-[[3-[6-[3-[3-(4-aminopiperidin-1-yl)propoxy]-2-methylphenyl]-1,3-benzoxazol-2-yl]phenyl]methylamino]ethanol (PubChem CID 177379652) has the molecular formula C31H38N4O3 and a molecular weight of 514.67 g/mol. Its IUPAC name is 2-[[3-[6-[3-[3-(4-aminopiperidin-1-yl)propoxy]-2-methylphenyl]-1,3-benzoxazol-2-yl]phenyl]methylamino]ethanol.
| Compound Name | 2-[[3-[6-[3-[3-(4-aminopiperidin-1-yl)propoxy]-2-methylphenyl]-1,3-benzoxazol-2-yl]phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 177379652 |
| Molecular Formula | C31H38N4O3 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | 2-[[3-[6-[3-[3-(4-aminopiperidin-1-yl)propoxy]-2-methylphenyl]-1,3-benzoxazol-2-yl]phenyl]methylamino]ethanol |
| SMILES | Cc1c(OCCCN2CCC(N)CC2)cccc1-c1ccc2nc(-c3cccc(CNCCO)c3)oc2c1 |
| InChI | InChI=1S/C31H38N4O3/c1-22-27(7-3-8-29(22)37-18-4-14-35-15-11-26(32)12-16-35)24-9-10-28-30(20-24)38-31(34-28)25-6-2-5-23(19-25)21-33-13-17-36/h2-3,5-10,19-20,26,33,36H,4,11-18,21,32H2,1H3 |
| InChIKey | QRWUNSAXMWFWJE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|