C21H24N2O3 — CID 175896939
4-[3-(2-morpholin-4-ylethoxy)phenyl]-2,3-dihydroindole-1-carbaldehyde (PubChem CID 175896939) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 4-[3-(2-morpholin-4-ylethoxy)phenyl]-2,3-dihydroindole-1-carbaldehyde.
| Compound Name | 4-[3-(2-morpholin-4-ylethoxy)phenyl]-2,3-dihydroindole-1-carbaldehyde |
|---|---|
| PubChem CID | 175896939 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 4-[3-(2-morpholin-4-ylethoxy)phenyl]-2,3-dihydroindole-1-carbaldehyde |
| SMILES | O=CN1CCc2c(-c3cccc(OCCN4CCOCC4)c3)cccc21 |
| InChI | InChI=1S/C21H24N2O3/c24-16-23-8-7-20-19(5-2-6-21(20)23)17-3-1-4-18(15-17)26-14-11-22-9-12-25-13-10-22/h1-6,15-16H,7-14H2 |
| InChIKey | ZPFPQWLNWLGPBD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|