C26H27N3O4 — CID 18403518
1-methyl-3-(1-methylindol-3-yl)-4-[3-(2-morpholin-4-ylethoxy)phenyl]pyrrole-2,5-dione (PubChem CID 18403518) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-methyl-3-(1-methylindol-3-yl)-4-[3-(2-morpholin-4-ylethoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 1-methyl-3-(1-methylindol-3-yl)-4-[3-(2-morpholin-4-ylethoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 18403518 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 1-methyl-3-(1-methylindol-3-yl)-4-[3-(2-morpholin-4-ylethoxy)phenyl]pyrrole-2,5-dione |
| SMILES | CN1C(=O)C(c2cccc(OCCN3CCOCC3)c2)=C(c2cn(C)c3ccccc23)C1=O |
| InChI | InChI=1S/C26H27N3O4/c1-27-17-21(20-8-3-4-9-22(20)27)24-23(25(30)28(2)26(24)31)18-6-5-7-19(16-18)33-15-12-29-10-13-32-14-11-29/h3-9,16-17H,10-15H2,1-2H3 |
| InChIKey | PSEOYAJTIDRZRO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|