C27H23F2NO3 — CID 51002326
2-(3,4-difluorophenyl)-6-(2-morpholin-4-ylethoxy)-3-phenylinden-1-one (PubChem CID 51002326) has the molecular formula C27H23F2NO3 and a molecular weight of 447.48 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-6-(2-morpholin-4-ylethoxy)-3-phenylinden-1-one.
| Compound Name | 2-(3,4-difluorophenyl)-6-(2-morpholin-4-ylethoxy)-3-phenylinden-1-one |
|---|---|
| PubChem CID | 51002326 |
| Molecular Formula | C27H23F2NO3 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 2-(3,4-difluorophenyl)-6-(2-morpholin-4-ylethoxy)-3-phenylinden-1-one |
| SMILES | O=C1C(c2ccc(F)c(F)c2)=C(c2ccccc2)c2ccc(OCCN3CCOCC3)cc21 |
| InChI | InChI=1S/C27H23F2NO3/c28-23-9-6-19(16-24(23)29)26-25(18-4-2-1-3-5-18)21-8-7-20(17-22(21)27(26)31)33-15-12-30-10-13-32-14-11-30/h1-9,16-17H,10-15H2 |
| InChIKey | JJEKQXSMKTZXIQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|