C26H23ClN2O3 — CID 51002367
3-(4-chlorophenyl)-6-(2-morpholin-4-ylethoxy)-2-pyridin-3-ylinden-1-one (PubChem CID 51002367) has the molecular formula C26H23ClN2O3 and a molecular weight of 446.93 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-6-(2-morpholin-4-ylethoxy)-2-pyridin-3-ylinden-1-one.
| Compound Name | 3-(4-chlorophenyl)-6-(2-morpholin-4-ylethoxy)-2-pyridin-3-ylinden-1-one |
|---|---|
| PubChem CID | 51002367 |
| Molecular Formula | C26H23ClN2O3 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 3-(4-chlorophenyl)-6-(2-morpholin-4-ylethoxy)-2-pyridin-3-ylinden-1-one |
| SMILES | O=C1C(c2cccnc2)=C(c2ccc(Cl)cc2)c2ccc(OCCN3CCOCC3)cc21 |
| InChI | InChI=1S/C26H23ClN2O3/c27-20-5-3-18(4-6-20)24-22-8-7-21(32-15-12-29-10-13-31-14-11-29)16-23(22)26(30)25(24)19-2-1-9-28-17-19/h1-9,16-17H,10-15H2 |
| InChIKey | GRKCUATXPUWMRI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |