C26H27N5O2 — CID 67298576
5-methyl-6-[4-(2-morpholin-4-ylethoxy)phenyl]-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 67298576) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 5-methyl-6-[4-(2-morpholin-4-ylethoxy)phenyl]-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | 5-methyl-6-[4-(2-morpholin-4-ylethoxy)phenyl]-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 67298576 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 5-methyl-6-[4-(2-morpholin-4-ylethoxy)phenyl]-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | Cc1c(-c2ccc(OCCN3CCOCC3)cc2)ccc2nc(-c3cccnc3)nc(N)c12 |
| InChI | InChI=1S/C26H27N5O2/c1-18-22(19-4-6-21(7-5-19)33-16-13-31-11-14-32-15-12-31)8-9-23-24(18)25(27)30-26(29-23)20-3-2-10-28-17-20/h2-10,17H,11-16H2,1H3,(H2,27,29,30) |
| InChIKey | QFVXXWPEPWJEDO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |