C21H15F2N3 — CID 159998467
6-(3,5-difluorophenyl)-4,5-dimethyl-2-pyridin-3-ylquinazoline (PubChem CID 159998467) has the molecular formula C21H15F2N3 and a molecular weight of 347.37 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-4,5-dimethyl-2-pyridin-3-ylquinazoline.
| Compound Name | 6-(3,5-difluorophenyl)-4,5-dimethyl-2-pyridin-3-ylquinazoline |
|---|---|
| PubChem CID | 159998467 |
| Molecular Formula | C21H15F2N3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 6-(3,5-difluorophenyl)-4,5-dimethyl-2-pyridin-3-ylquinazoline |
| SMILES | Cc1nc(-c2cccnc2)nc2ccc(-c3cc(F)cc(F)c3)c(C)c12 |
| InChI | InChI=1S/C21H15F2N3/c1-12-18(15-8-16(22)10-17(23)9-15)5-6-19-20(12)13(2)25-21(26-19)14-4-3-7-24-11-14/h3-11H,1-2H3 |
| InChIKey | QZMMZVLHWLYHIS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |