C20H12F2N4 — CID 123770946
10-(3,4-difluorophenyl)-2-methyl-5-pyridin-3-yl-2,4,6-triazatricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaene (PubChem CID 123770946) has the molecular formula C20H12F2N4 and a molecular weight of 346.34 g/mol. Its IUPAC name is 10-(3,4-difluorophenyl)-2-methyl-5-pyridin-3-yl-2,4,6-triazatricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaene.
| Compound Name | 10-(3,4-difluorophenyl)-2-methyl-5-pyridin-3-yl-2,4,6-triazatricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaene |
|---|---|
| PubChem CID | 123770946 |
| Molecular Formula | C20H12F2N4 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 10-(3,4-difluorophenyl)-2-methyl-5-pyridin-3-yl-2,4,6-triazatricyclo[5.3.1.03,11]undeca-1(10),3,5,7(11),8-pentaene |
| SMILES | CN1c2nc(-c3cccnc3)nc3ccc(-c4ccc(F)c(F)c4)c1c23 |
| InChI | InChI=1S/C20H12F2N4/c1-26-18-13(11-4-6-14(21)15(22)9-11)5-7-16-17(18)20(26)25-19(24-16)12-3-2-8-23-10-12/h2-10H,1H3 |
| InChIKey | FBSLVPAWURDBKL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |