C21H16F2N4 — CID 71180280
7-(3,4-difluorophenyl)-N,8-dimethyl-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 71180280) has the molecular formula C21H16F2N4 and a molecular weight of 362.38 g/mol. Its IUPAC name is 7-(3,4-difluorophenyl)-N,8-dimethyl-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | 7-(3,4-difluorophenyl)-N,8-dimethyl-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 71180280 |
| Molecular Formula | C21H16F2N4 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 7-(3,4-difluorophenyl)-N,8-dimethyl-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | CNc1nc(-c2cccnc2)nc2c(C)c(-c3ccc(F)c(F)c3)ccc12 |
| InChI | InChI=1S/C21H16F2N4/c1-12-15(13-5-8-17(22)18(23)10-13)6-7-16-19(12)26-20(27-21(16)24-2)14-4-3-9-25-11-14/h3-11H,1-2H3,(H,24,26,27) |
| InChIKey | JGCFSVASDABGAP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |