C22H17N5 — CID 71274618
4-[8-methyl-4-(methylamino)-2-pyridin-3-ylquinazolin-7-yl]benzonitrile (PubChem CID 71274618) has the molecular formula C22H17N5 and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-[8-methyl-4-(methylamino)-2-pyridin-3-ylquinazolin-7-yl]benzonitrile.
| Compound Name | 4-[8-methyl-4-(methylamino)-2-pyridin-3-ylquinazolin-7-yl]benzonitrile |
|---|---|
| PubChem CID | 71274618 |
| Molecular Formula | C22H17N5 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 4-[8-methyl-4-(methylamino)-2-pyridin-3-ylquinazolin-7-yl]benzonitrile |
| SMILES | CNc1nc(-c2cccnc2)nc2c(C)c(-c3ccc(C#N)cc3)ccc12 |
| InChI | InChI=1S/C22H17N5/c1-14-18(16-7-5-15(12-23)6-8-16)9-10-19-20(14)26-21(27-22(19)24-2)17-4-3-11-25-13-17/h3-11,13H,1-2H3,(H,24,26,27) |
| InChIKey | ANUDURRQSLOVCG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |