C21H15N5 — CID 123812922
7-(4-isocyanophenyl)-N-methyl-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 123812922) has the molecular formula C21H15N5 and a molecular weight of 337.39 g/mol. Its IUPAC name is 7-(4-isocyanophenyl)-N-methyl-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | 7-(4-isocyanophenyl)-N-methyl-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 123812922 |
| Molecular Formula | C21H15N5 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 7-(4-isocyanophenyl)-N-methyl-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3c(NC)nc(-c4cccnc4)nc3c2)cc1 |
| InChI | InChI=1S/C21H15N5/c1-22-17-8-5-14(6-9-17)15-7-10-18-19(12-15)25-20(26-21(18)23-2)16-4-3-11-24-13-16/h3-13H,2H3,(H,23,25,26) |
| InChIKey | HXDFNZQLTAHJJD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 55.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|