C21H13N5 — CID 122494301
4-[4-(methylideneamino)-2-pyridin-3-ylquinazolin-6-yl]benzonitrile (PubChem CID 122494301) has the molecular formula C21H13N5 and a molecular weight of 335.37 g/mol. Its IUPAC name is 4-[4-(methylideneamino)-2-pyridin-3-ylquinazolin-6-yl]benzonitrile.
| Compound Name | 4-[4-(methylideneamino)-2-pyridin-3-ylquinazolin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 122494301 |
| Molecular Formula | C21H13N5 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 4-[4-(methylideneamino)-2-pyridin-3-ylquinazolin-6-yl]benzonitrile |
| SMILES | C=Nc1nc(-c2cccnc2)nc2ccc(-c3ccc(C#N)cc3)cc12 |
| InChI | InChI=1S/C21H13N5/c1-23-21-18-11-16(15-6-4-14(12-22)5-7-15)8-9-19(18)25-20(26-21)17-3-2-10-24-13-17/h2-11,13H,1H2 |
| InChIKey | POWYVKVKBOVBHI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 74.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|