C52H30N4S2 — CID 130263265
4-[6-[3,5-di(dibenzothiophen-2-yl)phenyl]-2-(4-pyridin-3-ylphenyl)pyrimidin-4-yl]benzonitrile (PubChem CID 130263265) has the molecular formula C52H30N4S2 and a molecular weight of 774.97 g/mol. Its IUPAC name is 4-[6-[3,5-di(dibenzothiophen-2-yl)phenyl]-2-(4-pyridin-3-ylphenyl)pyrimidin-4-yl]benzonitrile.
| Compound Name | 4-[6-[3,5-di(dibenzothiophen-2-yl)phenyl]-2-(4-pyridin-3-ylphenyl)pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 130263265 |
| Molecular Formula | C52H30N4S2 |
| Molecular Weight | 774.97 g/mol |
| Exact Mass | 774.19 |
| IUPAC Name | 4-[6-[3,5-di(dibenzothiophen-2-yl)phenyl]-2-(4-pyridin-3-ylphenyl)pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(-c3cc(-c4ccc5sc6ccccc6c5c4)cc(-c4ccc5sc6ccccc6c5c4)c3)nc(-c3ccc(-c4cccnc4)cc3)n2)cc1 |
| InChI | InChI=1S/C52H30N4S2/c53-30-32-11-13-34(14-12-32)46-29-47(56-52(55-46)35-17-15-33(16-18-35)38-6-5-23-54-31-38)41-25-39(36-19-21-50-44(27-36)42-7-1-3-9-48(42)57-50)24-40(26-41)37-20-22-51-45(28-37)43-8-2-4-10-49(43)58-51/h1-29,31H |
| InChIKey | DKTHNZWECHDCEZ-UHFFFAOYSA-N |
| XLogP | 14.48 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.97 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |