C34H20N4S — CID 130262648
4-[6-dibenzothiophen-2-yl-2-(2-pyridin-3-ylphenyl)pyrimidin-4-yl]benzonitrile (PubChem CID 130262648) has the molecular formula C34H20N4S and a molecular weight of 516.63 g/mol. Its IUPAC name is 4-[6-dibenzothiophen-2-yl-2-(2-pyridin-3-ylphenyl)pyrimidin-4-yl]benzonitrile.
| Compound Name | 4-[6-dibenzothiophen-2-yl-2-(2-pyridin-3-ylphenyl)pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 130262648 |
| Molecular Formula | C34H20N4S |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 4-[6-dibenzothiophen-2-yl-2-(2-pyridin-3-ylphenyl)pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(-c3ccc4sc5ccccc5c4c3)nc(-c3ccccc3-c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C34H20N4S/c35-20-22-11-13-23(14-12-22)30-19-31(24-15-16-33-29(18-24)27-8-3-4-10-32(27)39-33)38-34(37-30)28-9-2-1-7-26(28)25-6-5-17-36-21-25/h1-19,21H |
| InChIKey | KAEOREYMLDOXNL-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |