C40H24N4S — CID 130262033
4-[6-(4-dibenzothiophen-2-ylphenyl)-2-(3-pyridin-3-ylphenyl)pyrimidin-4-yl]benzonitrile (PubChem CID 130262033) has the molecular formula C40H24N4S and a molecular weight of 592.73 g/mol. Its IUPAC name is 4-[6-(4-dibenzothiophen-2-ylphenyl)-2-(3-pyridin-3-ylphenyl)pyrimidin-4-yl]benzonitrile.
| Compound Name | 4-[6-(4-dibenzothiophen-2-ylphenyl)-2-(3-pyridin-3-ylphenyl)pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 130262033 |
| Molecular Formula | C40H24N4S |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | 4-[6-(4-dibenzothiophen-2-ylphenyl)-2-(3-pyridin-3-ylphenyl)pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(-c3ccc(-c4ccc5sc6ccccc6c5c4)cc3)nc(-c3cccc(-c4cccnc4)c3)n2)cc1 |
| InChI | InChI=1S/C40H24N4S/c41-24-26-10-12-28(13-11-26)36-23-37(44-40(43-36)32-6-3-5-30(21-32)33-7-4-20-42-25-33)29-16-14-27(15-17-29)31-18-19-39-35(22-31)34-8-1-2-9-38(34)45-39/h1-23,25H |
| InChIKey | LQYXBUZZFJHTQU-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |