C51H31N3S2 — CID 130262719
2-[3,5-di(dibenzothiophen-3-yl)phenyl]-4-phenyl-6-(4-pyridin-3-ylphenyl)pyrimidine (PubChem CID 130262719) has the molecular formula C51H31N3S2 and a molecular weight of 749.96 g/mol. Its IUPAC name is 2-[3,5-di(dibenzothiophen-3-yl)phenyl]-4-phenyl-6-(4-pyridin-3-ylphenyl)pyrimidine.
| Compound Name | 2-[3,5-di(dibenzothiophen-3-yl)phenyl]-4-phenyl-6-(4-pyridin-3-ylphenyl)pyrimidine |
|---|---|
| PubChem CID | 130262719 |
| Molecular Formula | C51H31N3S2 |
| Molecular Weight | 749.96 g/mol |
| Exact Mass | 749.20 |
| IUPAC Name | 2-[3,5-di(dibenzothiophen-3-yl)phenyl]-4-phenyl-6-(4-pyridin-3-ylphenyl)pyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4cccnc4)cc3)nc(-c3cc(-c4ccc5c(c4)sc4ccccc45)cc(-c4ccc5c(c4)sc4ccccc45)c3)n2)cc1 |
| InChI | InChI=1S/C51H31N3S2/c1-2-9-33(10-3-1)45-30-46(34-18-16-32(17-19-34)37-11-8-24-52-31-37)54-51(53-45)40-26-38(35-20-22-43-41-12-4-6-14-47(41)55-49(43)28-35)25-39(27-40)36-21-23-44-42-13-5-7-15-48(42)56-50(44)29-36/h1-31H |
| InChIKey | NXRJIXPLMNZVMF-UHFFFAOYSA-N |
| XLogP | 14.61 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.96 |
| LogP ≤ 5 | 14.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |