C28H19N3S — CID 155603301
4-dibenzothiophen-3-yl-2-methyl-6-(4-pyridin-3-ylphenyl)pyrimidine (PubChem CID 155603301) has the molecular formula C28H19N3S and a molecular weight of 429.55 g/mol. Its IUPAC name is 4-dibenzothiophen-3-yl-2-methyl-6-(4-pyridin-3-ylphenyl)pyrimidine.
| Compound Name | 4-dibenzothiophen-3-yl-2-methyl-6-(4-pyridin-3-ylphenyl)pyrimidine |
|---|---|
| PubChem CID | 155603301 |
| Molecular Formula | C28H19N3S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 4-dibenzothiophen-3-yl-2-methyl-6-(4-pyridin-3-ylphenyl)pyrimidine |
| SMILES | Cc1nc(-c2ccc(-c3cccnc3)cc2)cc(-c2ccc3c(c2)sc2ccccc23)n1 |
| InChI | InChI=1S/C28H19N3S/c1-18-30-25(20-10-8-19(9-11-20)22-5-4-14-29-17-22)16-26(31-18)21-12-13-24-23-6-2-3-7-27(23)32-28(24)15-21/h2-17H,1H3 |
| InChIKey | YIQJIRFLPCBVIJ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |