C17H12N6 — CID 71180731
2-pyridin-3-yl-6-pyrimidin-5-ylquinazolin-4-amine (PubChem CID 71180731) has the molecular formula C17H12N6 and a molecular weight of 300.33 g/mol. Its IUPAC name is 2-pyridin-3-yl-6-pyrimidin-5-ylquinazolin-4-amine.
| Compound Name | 2-pyridin-3-yl-6-pyrimidin-5-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 71180731 |
| Molecular Formula | C17H12N6 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-pyridin-3-yl-6-pyrimidin-5-ylquinazolin-4-amine |
| SMILES | Nc1nc(-c2cccnc2)nc2ccc(-c3cncnc3)cc12 |
| InChI | InChI=1S/C17H12N6/c18-16-14-6-11(13-8-20-10-21-9-13)3-4-15(14)22-17(23-16)12-2-1-5-19-7-12/h1-10H,(H2,18,22,23) |
| InChIKey | BUWUJOUVEGOMEH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |