C11H6BrF2N — CID 164533968
3-(4-bromo-3,5-difluorophenyl)pyridine (PubChem CID 164533968) has the molecular formula C11H6BrF2N and a molecular weight of 270.08 g/mol. Its IUPAC name is 3-(4-bromo-3,5-difluorophenyl)pyridine.
| Compound Name | 3-(4-bromo-3,5-difluorophenyl)pyridine |
|---|---|
| PubChem CID | 164533968 |
| Molecular Formula | C11H6BrF2N |
| Molecular Weight | 270.08 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | 3-(4-bromo-3,5-difluorophenyl)pyridine |
| SMILES | Fc1cc(-c2cccnc2)cc(F)c1Br |
| InChI | InChI=1S/C11H6BrF2N/c12-11-9(13)4-8(5-10(11)14)7-2-1-3-15-6-7/h1-6H |
| InChIKey | RAGQYFJDOGDWHS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.08 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|