C28H25ClF2N2O4S — CID 51001832
3-(4-chlorophenyl)-2-(3,4-difluorophenyl)-6-[2-(4-methylsulfonylpiperazin-1-yl)ethoxy]inden-1-one (PubChem CID 51001832) has the molecular formula C28H25ClF2N2O4S and a molecular weight of 559.03 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(3,4-difluorophenyl)-6-[2-(4-methylsulfonylpiperazin-1-yl)ethoxy]inden-1-one.
| Compound Name | 3-(4-chlorophenyl)-2-(3,4-difluorophenyl)-6-[2-(4-methylsulfonylpiperazin-1-yl)ethoxy]inden-1-one |
|---|---|
| PubChem CID | 51001832 |
| Molecular Formula | C28H25ClF2N2O4S |
| Molecular Weight | 559.03 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(3,4-difluorophenyl)-6-[2-(4-methylsulfonylpiperazin-1-yl)ethoxy]inden-1-one |
| SMILES | CS(=O)(=O)N1CCN(CCOc2ccc3c(c2)C(=O)C(c2ccc(F)c(F)c2)=C3c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C28H25ClF2N2O4S/c1-38(35,36)33-12-10-32(11-13-33)14-15-37-21-7-8-22-23(17-21)28(34)27(19-4-9-24(30)25(31)16-19)26(22)18-2-5-20(29)6-3-18/h2-9,16-17H,10-15H2,1H3 |
| InChIKey | YHKGOKWFIMBWPV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.03 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|