C30H29F3N2O5S — CID 70314319
3-(2,4-difluorophenyl)-2-(3-fluoro-4-methoxyphenyl)-6-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]inden-1-one (PubChem CID 70314319) has the molecular formula C30H29F3N2O5S and a molecular weight of 586.63 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-2-(3-fluoro-4-methoxyphenyl)-6-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]inden-1-one.
| Compound Name | 3-(2,4-difluorophenyl)-2-(3-fluoro-4-methoxyphenyl)-6-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]inden-1-one |
|---|---|
| PubChem CID | 70314319 |
| Molecular Formula | C30H29F3N2O5S |
| Molecular Weight | 586.63 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | 3-(2,4-difluorophenyl)-2-(3-fluoro-4-methoxyphenyl)-6-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]inden-1-one |
| SMILES | COc1ccc(C2=C(c3ccc(F)cc3F)c3ccc(OCCCN4CCN(S(C)(=O)=O)CC4)cc3C2=O)cc1F |
| InChI | InChI=1S/C30H29F3N2O5S/c1-39-27-9-4-19(16-26(27)33)28-29(23-7-5-20(31)17-25(23)32)22-8-6-21(18-24(22)30(28)36)40-15-3-10-34-11-13-35(14-12-34)41(2,37)38/h4-9,16-18H,3,10-15H2,1-2H3 |
| InChIKey | DUBSQNZGZTVLBU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|