C22H26FN3O2 — CID 112839730
4-[3-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]propoxy]benzonitrile (PubChem CID 112839730) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-[3-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]propoxy]benzonitrile.
| Compound Name | 4-[3-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 112839730 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 4-[3-[4-[(5-fluoro-2-methoxyphenyl)methyl]piperazin-1-yl]propoxy]benzonitrile |
| SMILES | COc1ccc(F)cc1CN1CCN(CCCOc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C22H26FN3O2/c1-27-22-8-5-20(23)15-19(22)17-26-12-10-25(11-13-26)9-2-14-28-21-6-3-18(16-24)4-7-21/h3-8,15H,2,9-14,17H2,1H3 |
| InChIKey | QCZHHWYEEIFSHQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|