C29H25F5N2O4S — CID 51002537
2-(3,4-difluorophenyl)-6-[2-(4-methylsulfonylpiperazin-1-yl)ethoxy]-3-[4-(trifluoromethyl)phenyl]inden-1-one (PubChem CID 51002537) has the molecular formula C29H25F5N2O4S and a molecular weight of 592.59 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-6-[2-(4-methylsulfonylpiperazin-1-yl)ethoxy]-3-[4-(trifluoromethyl)phenyl]inden-1-one.
| Compound Name | 2-(3,4-difluorophenyl)-6-[2-(4-methylsulfonylpiperazin-1-yl)ethoxy]-3-[4-(trifluoromethyl)phenyl]inden-1-one |
|---|---|
| PubChem CID | 51002537 |
| Molecular Formula | C29H25F5N2O4S |
| Molecular Weight | 592.59 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | 2-(3,4-difluorophenyl)-6-[2-(4-methylsulfonylpiperazin-1-yl)ethoxy]-3-[4-(trifluoromethyl)phenyl]inden-1-one |
| SMILES | CS(=O)(=O)N1CCN(CCOc2ccc3c(c2)C(=O)C(c2ccc(F)c(F)c2)=C3c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C29H25F5N2O4S/c1-41(38,39)36-12-10-35(11-13-36)14-15-40-21-7-8-22-23(17-21)28(37)27(19-4-9-24(30)25(31)16-19)26(22)18-2-5-20(6-3-18)29(32,33)34/h2-9,16-17H,10-15H2,1H3 |
| InChIKey | OAEVFLHATSTZMN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|