C25H30N2O5 — CID 57066277
3,5-bis(2-morpholin-4-ylethoxy)fluoren-9-one (PubChem CID 57066277) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is 3,5-bis(2-morpholin-4-ylethoxy)fluoren-9-one.
| Compound Name | 3,5-bis(2-morpholin-4-ylethoxy)fluoren-9-one |
|---|---|
| PubChem CID | 57066277 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 3,5-bis(2-morpholin-4-ylethoxy)fluoren-9-one |
| SMILES | O=C1c2ccc(OCCN3CCOCC3)cc2-c2c(OCCN3CCOCC3)cccc21 |
| InChI | InChI=1S/C25H30N2O5/c28-25-20-5-4-19(31-16-10-26-6-12-29-13-7-26)18-22(20)24-21(25)2-1-3-23(24)32-17-11-27-8-14-30-15-9-27/h1-5,18H,6-17H2 |
| InChIKey | XUQBYNSGEPISOL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |