C22H20FNO5 — CID 170549572
2-(4-fluorophenoxy)-5-(2-morpholin-4-ylethoxy)naphthalene-1,4-dione (PubChem CID 170549572) has the molecular formula C22H20FNO5 and a molecular weight of 397.40 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-5-(2-morpholin-4-ylethoxy)naphthalene-1,4-dione.
| Compound Name | 2-(4-fluorophenoxy)-5-(2-morpholin-4-ylethoxy)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 170549572 |
| Molecular Formula | C22H20FNO5 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-(4-fluorophenoxy)-5-(2-morpholin-4-ylethoxy)naphthalene-1,4-dione |
| SMILES | O=C1C(Oc2ccc(F)cc2)=CC(=O)c2c(OCCN3CCOCC3)cccc21 |
| InChI | InChI=1S/C22H20FNO5/c23-15-4-6-16(7-5-15)29-20-14-18(25)21-17(22(20)26)2-1-3-19(21)28-13-10-24-8-11-27-12-9-24/h1-7,14H,8-13H2 |
| InChIKey | QYHQHZNAXOOIRU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|