C24H27NO5 — CID 163275887
5-(2-morpholin-4-ylethoxy)-2-[(3E,5Z)-octa-1,3,5-trien-3-yl]oxynaphthalene-1,4-dione (PubChem CID 163275887) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 5-(2-morpholin-4-ylethoxy)-2-[(3E,5Z)-octa-1,3,5-trien-3-yl]oxynaphthalene-1,4-dione.
| Compound Name | 5-(2-morpholin-4-ylethoxy)-2-[(3E,5Z)-octa-1,3,5-trien-3-yl]oxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 163275887 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 5-(2-morpholin-4-ylethoxy)-2-[(3E,5Z)-octa-1,3,5-trien-3-yl]oxynaphthalene-1,4-dione |
| SMILES | C=C/C(=C\C=C/CC)OC1=CC(=O)c2c(OCCN3CCOCC3)cccc2C1=O |
| InChI | InChI=1S/C24H27NO5/c1-3-5-6-8-18(4-2)30-22-17-20(26)23-19(24(22)27)9-7-10-21(23)29-16-13-25-11-14-28-15-12-25/h4-10,17H,2-3,11-16H2,1H3/b6-5-,18-8+ |
| InChIKey | YETAJTYMDVFXRN-CWXWLJRESA-N |
| XLogP | 3.71 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|