C21H22N2O5 — CID 67872717
2-(aminomethyl)-1-hydroxy-8-(2-morpholin-4-ylethoxy)anthracene-9,10-dione (PubChem CID 67872717) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is 2-(aminomethyl)-1-hydroxy-8-(2-morpholin-4-ylethoxy)anthracene-9,10-dione.
| Compound Name | 2-(aminomethyl)-1-hydroxy-8-(2-morpholin-4-ylethoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 67872717 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-(aminomethyl)-1-hydroxy-8-(2-morpholin-4-ylethoxy)anthracene-9,10-dione |
| SMILES | NCc1ccc2c(c1O)C(=O)c1c(OCCN3CCOCC3)cccc1C2=O |
| InChI | InChI=1S/C21H22N2O5/c22-12-13-4-5-15-18(19(13)24)21(26)17-14(20(15)25)2-1-3-16(17)28-11-8-23-6-9-27-10-7-23/h1-5,24H,6-12,22H2 |
| InChIKey | ZFUUEBIBDNAPKT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|