C18H14O4 — CID 122185484
5-methoxy-2-(4-methylphenoxy)naphthalene-1,4-dione (PubChem CID 122185484) has the molecular formula C18H14O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 5-methoxy-2-(4-methylphenoxy)naphthalene-1,4-dione.
| Compound Name | 5-methoxy-2-(4-methylphenoxy)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 122185484 |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 5-methoxy-2-(4-methylphenoxy)naphthalene-1,4-dione |
| SMILES | COc1cccc2c1C(=O)C=C(Oc1ccc(C)cc1)C2=O |
| InChI | InChI=1S/C18H14O4/c1-11-6-8-12(9-7-11)22-16-10-14(19)17-13(18(16)20)4-3-5-15(17)21-2/h3-10H,1-2H3 |
| InChIKey | TZQXOUCVVSZTRM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|