methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate

C15H12O5 — CID 170895316

IUPACmethyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate
SMILESCOC(=O)/C=C/C1=CC(=O)c2c(OC)cccc2C1=O
InChIInChI=1S/C15H12O5/c1-19-12-5-3-4-10-14(12)11(16)8-9(15(10)18)6-7-13(17)20-2/h3-8H,1-2H3/b7-6+
InChIKeyNRJGMISGFYXJEA-VOTSOKGWSA-N
MW272.26 g/mol
LogP1.73
Rot. Bonds3

About methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate

methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate (PubChem CID 170895316) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate.

Molecular Properties

Compound Namemethyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate
PubChem CID170895316
Molecular FormulaC15H12O5
Molecular Weight272.26 g/mol
Exact Mass272.07
IUPAC Namemethyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate
SMILESCOC(=O)/C=C/C1=CC(=O)c2c(OC)cccc2C1=O
InChIInChI=1S/C15H12O5/c1-19-12-5-3-4-10-14(12)11(16)8-9(15(10)18)6-7-13(17)20-2/h3-8H,1-2H3/b7-6+
InChIKeyNRJGMISGFYXJEA-VOTSOKGWSA-N
XLogP1.73
TPSA69.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.26
LogP ≤ 51.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate?
The IUPAC name of methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate (CID 170895316) is methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate.
What is the SMILES notation for methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate?
The canonical SMILES for methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate is COC(=O)/C=C/C1=CC(=O)c2c(OC)cccc2C1=O.
What is the InChIKey of methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate?
The InChIKey is NRJGMISGFYXJEA-VOTSOKGWSA-N. The full InChI is InChI=1S/C15H12O5/c1-19-12-5-3-4-10-14(12)11(16)8-9(15(10)18)6-7-13(17)20-2/h3-8H,1-2H3/b7-6+.
What are the key properties of methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate?
methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate has a molecular weight of 272.26 g/mol, XLogP of 1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate is sourced from PubChem (CID 170895316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).