C15H12O5 — CID 170895316
methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate (PubChem CID 170895316) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate.
| Compound Name | methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 170895316 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | methyl (E)-3-(5-methoxy-1,4-dioxonaphthalen-2-yl)prop-2-enoate |
| SMILES | COC(=O)/C=C/C1=CC(=O)c2c(OC)cccc2C1=O |
| InChI | InChI=1S/C15H12O5/c1-19-12-5-3-4-10-14(12)11(16)8-9(15(10)18)6-7-13(17)20-2/h3-8H,1-2H3/b7-6+ |
| InChIKey | NRJGMISGFYXJEA-VOTSOKGWSA-N |
| XLogP | 1.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|