C18H13NO4 — CID 170895334
(6-anilino-5,8-dioxonaphthalen-1-yl) acetate (PubChem CID 170895334) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is (6-anilino-5,8-dioxonaphthalen-1-yl) acetate.
| Compound Name | (6-anilino-5,8-dioxonaphthalen-1-yl) acetate |
|---|---|
| PubChem CID | 170895334 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (6-anilino-5,8-dioxonaphthalen-1-yl) acetate |
| SMILES | CC(=O)Oc1cccc2c1C(=O)C=C(Nc1ccccc1)C2=O |
| InChI | InChI=1S/C18H13NO4/c1-11(20)23-16-9-5-8-13-17(16)15(21)10-14(18(13)22)19-12-6-3-2-4-7-12/h2-10,19H,1H3 |
| InChIKey | XRQNVFZBYLCBLU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|