C16H12N2O4S — CID 71726834
7-anilino-5,8-dioxonaphthalene-1-sulfonamide (PubChem CID 71726834) has the molecular formula C16H12N2O4S and a molecular weight of 328.35 g/mol. Its IUPAC name is 7-anilino-5,8-dioxonaphthalene-1-sulfonamide.
| Compound Name | 7-anilino-5,8-dioxonaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 71726834 |
| Molecular Formula | C16H12N2O4S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 7-anilino-5,8-dioxonaphthalene-1-sulfonamide |
| SMILES | NS(=O)(=O)c1cccc2c1C(=O)C(Nc1ccccc1)=CC2=O |
| InChI | InChI=1S/C16H12N2O4S/c17-23(21,22)14-8-4-7-11-13(19)9-12(16(20)15(11)14)18-10-5-2-1-3-6-10/h1-9,18H,(H2,17,21,22) |
| InChIKey | SVZZSTPSCYSADN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|