About 7-anilino-5,8-dioxonaphthalene-1-sulfonamide
7-anilino-5,8-dioxonaphthalene-1-sulfonamide (PubChem CID 71726834) has the molecular formula C16H12N2O4S
and a molecular weight of 328.35 g/mol. Its IUPAC name is 7-anilino-5,8-dioxonaphthalene-1-sulfonamide.
Molecular Properties
| Compound Name | 7-anilino-5,8-dioxonaphthalene-1-sulfonamide |
| PubChem CID | 71726834 |
| Molecular Formula | C16H12N2O4S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 7-anilino-5,8-dioxonaphthalene-1-sulfonamide |
| SMILES | NS(=O)(=O)c1cccc2c1C(=O)C(Nc1ccccc1)=CC2=O |
| InChI | InChI=1S/C16H12N2O4S/c17-23(21,22)14-8-4-7-11-13(19)9-12(16(20)15(11)14)18-10-5-2-1-3-6-10/h1-9,18H,(H2,17,21,22) |
| InChIKey | SVZZSTPSCYSADN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 7-anilino-5,8-dioxonaphthalene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-anilino-5,8-dioxonaphthalene-1-sulfonamide?
The IUPAC name of 7-anilino-5,8-dioxonaphthalene-1-sulfonamide (CID 71726834) is 7-anilino-5,8-dioxonaphthalene-1-sulfonamide.
What is the SMILES notation for 7-anilino-5,8-dioxonaphthalene-1-sulfonamide?
The canonical SMILES for 7-anilino-5,8-dioxonaphthalene-1-sulfonamide is NS(=O)(=O)c1cccc2c1C(=O)C(Nc1ccccc1)=CC2=O.
What is the InChIKey of 7-anilino-5,8-dioxonaphthalene-1-sulfonamide?
The InChIKey is SVZZSTPSCYSADN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O4S/c17-23(21,22)14-8-4-7-11-13(19)9-12(16(20)15(11)14)18-10-5-2-1-3-6-10/h1-9,18H,(H2,17,21,22).
What are the key properties of 7-anilino-5,8-dioxonaphthalene-1-sulfonamide?
7-anilino-5,8-dioxonaphthalene-1-sulfonamide has a molecular weight of 328.35 g/mol, XLogP of 1.71, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-anilino-5,8-dioxonaphthalene-1-sulfonamide is sourced from PubChem (CID 71726834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).